C27H19N5 — CID 87412124
2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-5-isocyano-1-methylimidazole-4-carbonitrile (PubChem CID 87412124) has the molecular formula C27H19N5 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-5-isocyano-1-methylimidazole-4-carbonitrile.
| Compound Name | 2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-5-isocyano-1-methylimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 87412124 |
| Molecular Formula | C27H19N5 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-5-isocyano-1-methylimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)nc(-n2c3ccccc3c3cc4c(cc32)-c2ccccc2C4(C)C)n1C |
| InChI | InChI=1S/C27H19N5/c1-27(2)20-11-7-5-9-16(20)18-14-24-19(13-21(18)27)17-10-6-8-12-23(17)32(24)26-30-22(15-28)25(29-3)31(26)4/h5-14H,1-2,4H3 |
| InChIKey | VNBFTKMXXGLWRD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 50.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|