C54H60N4 — CID 139550446
5-cyclohexyl-4,6-bis(3,6-ditert-butylcarbazol-9-yl)benzene-1,3-dicarbonitrile (PubChem CID 139550446) has the molecular formula C54H60N4 and a molecular weight of 765.10 g/mol. Its IUPAC name is 5-cyclohexyl-4,6-bis(3,6-ditert-butylcarbazol-9-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 5-cyclohexyl-4,6-bis(3,6-ditert-butylcarbazol-9-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139550446 |
| Molecular Formula | C54H60N4 |
| Molecular Weight | 765.10 g/mol |
| Exact Mass | 764.48 |
| IUPAC Name | 5-cyclohexyl-4,6-bis(3,6-ditert-butylcarbazol-9-yl)benzene-1,3-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(C#N)cc(C#N)c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c1C1CCCCC1 |
| InChI | InChI=1S/C54H60N4/c1-51(2,3)36-18-22-44-40(27-36)41-28-37(52(4,5)6)19-23-45(41)57(44)49-34(31-55)26-35(32-56)50(48(49)33-16-14-13-15-17-33)58-46-24-20-38(53(7,8)9)29-42(46)43-30-39(54(10,11)12)21-25-47(43)58/h18-30,33H,13-17H2,1-12H3 |
| InChIKey | VKDUWHPUVJDVJT-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.10 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |