C35H38N4 — CID 121407193
2-(3,6-ditert-butylcarbazol-9-yl)-4,6-dipropylbenzene-1,3,5-tricarbonitrile (PubChem CID 121407193) has the molecular formula C35H38N4 and a molecular weight of 514.72 g/mol. Its IUPAC name is 2-(3,6-ditert-butylcarbazol-9-yl)-4,6-dipropylbenzene-1,3,5-tricarbonitrile.
| Compound Name | 2-(3,6-ditert-butylcarbazol-9-yl)-4,6-dipropylbenzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 121407193 |
| Molecular Formula | C35H38N4 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 2-(3,6-ditert-butylcarbazol-9-yl)-4,6-dipropylbenzene-1,3,5-tricarbonitrile |
| SMILES | CCCc1c(C#N)c(CCC)c(C#N)c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c1C#N |
| InChI | InChI=1S/C35H38N4/c1-9-11-24-28(19-36)25(12-10-2)30(21-38)33(29(24)20-37)39-31-15-13-22(34(3,4)5)17-26(31)27-18-23(35(6,7)8)14-16-32(27)39/h13-18H,9-12H2,1-8H3 |
| InChIKey | LQRWGIYBUBIWHD-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |