C27H26BrFN2 — CID 154621448
4-bromo-2-(3,6-ditert-butylcarbazol-9-yl)-6-fluorobenzonitrile (PubChem CID 154621448) has the molecular formula C27H26BrFN2 and a molecular weight of 477.42 g/mol. Its IUPAC name is 4-bromo-2-(3,6-ditert-butylcarbazol-9-yl)-6-fluorobenzonitrile.
| Compound Name | 4-bromo-2-(3,6-ditert-butylcarbazol-9-yl)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 154621448 |
| Molecular Formula | C27H26BrFN2 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-bromo-2-(3,6-ditert-butylcarbazol-9-yl)-6-fluorobenzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(Br)cc(F)c1C#N |
| InChI | InChI=1S/C27H26BrFN2/c1-26(2,3)16-7-9-23-19(11-16)20-12-17(27(4,5)6)8-10-24(20)31(23)25-14-18(28)13-22(29)21(25)15-30/h7-14H,1-6H3 |
| InChIKey | BGCRHTKOFAHIKJ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |