C43H17F18N3 — CID 139402103
2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-[2,4-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 139402103) has the molecular formula C43H17F18N3 and a molecular weight of 917.59 g/mol. Its IUPAC name is 2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-[2,4-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-[2,4-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139402103 |
| Molecular Formula | C43H17F18N3 |
| Molecular Weight | 917.59 g/mol |
| Exact Mass | 917.11 |
| IUPAC Name | 2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-[2,4-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1c(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)cc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1-n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C43H17F18N3/c44-38(45,46)20-2-7-32-26(13-20)27-14-21(39(47,48)49)3-8-33(27)63(32)36-11-19(25-6-1-24(42(56,57)58)17-31(25)43(59,60)61)12-37(30(36)18-62)64-34-9-4-22(40(50,51)52)15-28(34)29-16-23(41(53,54)55)5-10-35(29)64/h1-17H |
| InChIKey | QIXIVOLUHSXQRC-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.59 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |