C49H31F6N9 — CID 134473797
4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile (PubChem CID 134473797) has the molecular formula C49H31F6N9 and a molecular weight of 859.84 g/mol. Its IUPAC name is 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134473797 |
| Molecular Formula | C49H31F6N9 |
| Molecular Weight | 859.84 g/mol |
| Exact Mass | 859.26 |
| IUPAC Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2cc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)cc(-n3c4ccccc4c4cc(-c5nc(C)nc(C)n5)ccc43)c2C#N)n1 |
| InChI | InChI=1S/C49H31F6N9/c1-25-57-26(2)60-46(59-25)29-13-17-42-36(19-29)34-9-5-7-11-40(34)63(42)44-21-31(33-16-15-32(48(50,51)52)23-39(33)49(53,54)55)22-45(38(44)24-56)64-41-12-8-6-10-35(41)37-20-30(14-18-43(37)64)47-61-27(3)58-28(4)62-47/h5-23H,1-4H3 |
| InChIKey | SUEONVLJNLVJCR-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 110.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.84 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |