C53H33F6N3 — CID 139402021
4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 139402021) has the molecular formula C53H33F6N3 and a molecular weight of 825.86 g/mol. Its IUPAC name is 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 139402021 |
| Molecular Formula | C53H33F6N3 |
| Molecular Weight | 825.86 g/mol |
| Exact Mass | 825.26 |
| IUPAC Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccccc4n(-c4cc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc(-n5c6ccccc6c6ccc(-c7ccc(C)cc7)cc65)c4C#N)c3c2)cc1 |
| InChI | InChI=1S/C53H33F6N3/c1-31-11-15-33(16-12-31)35-19-22-42-40-7-3-5-9-46(40)61(48(42)25-35)50-27-37(39-24-21-38(52(54,55)56)29-45(39)53(57,58)59)28-51(44(50)30-60)62-47-10-6-4-8-41(47)43-23-20-36(26-49(43)62)34-17-13-32(2)14-18-34/h3-29H,1-2H3 |
| InChIKey | UVBGKARWBKRLRC-UHFFFAOYSA-N |
| XLogP | 15.41 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.86 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |