C54H38F3N3 — CID 137386835
2,6-bis[2-(2,4-dimethylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137386835) has the molecular formula C54H38F3N3 and a molecular weight of 785.91 g/mol. Its IUPAC name is 2,6-bis[2-(2,4-dimethylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[2-(2,4-dimethylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137386835 |
| Molecular Formula | C54H38F3N3 |
| Molecular Weight | 785.91 g/mol |
| Exact Mass | 785.30 |
| IUPAC Name | 2,6-bis[2-(2,4-dimethylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccccc4n(-c4cc(-c5ccccc5C(F)(F)F)cc(-n5c6ccccc6c6ccc(-c7ccc(C)cc7C)cc65)c4C#N)c3c2)c(C)c1 |
| InChI | InChI=1S/C54H38F3N3/c1-32-17-21-39(34(3)25-32)36-19-23-44-42-12-6-9-15-48(42)59(50(44)27-36)52-29-38(41-11-5-8-14-47(41)54(55,56)57)30-53(46(52)31-58)60-49-16-10-7-13-43(49)45-24-20-37(28-51(45)60)40-22-18-33(2)26-35(40)4/h5-30H,1-4H3 |
| InChIKey | UMKLPANMHXZZSB-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.91 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |