C54H26F12N4 — CID 142466030
2,6-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile (PubChem CID 142466030) has the molecular formula C54H26F12N4 and a molecular weight of 958.81 g/mol. Its IUPAC name is 2,6-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile.
| Compound Name | 2,6-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 142466030 |
| Molecular Formula | C54H26F12N4 |
| Molecular Weight | 958.81 g/mol |
| Exact Mass | 958.20 |
| IUPAC Name | 2,6-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-n3c4ccccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c(C#N)c(-n3c4ccccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c2)c1 |
| InChI | InChI=1S/C54H26F12N4/c55-51(56,57)34-14-18-36(43(25-34)53(61,62)63)31-12-16-40-38-8-1-3-10-45(38)69(47(40)21-31)49-23-33(30-7-5-6-29(20-30)27-67)24-50(42(49)28-68)70-46-11-4-2-9-39(46)41-17-13-32(22-48(41)70)37-19-15-35(52(58,59)60)26-44(37)54(64,65)66/h1-26H |
| InChIKey | SKIFUBIKAOWXIA-UHFFFAOYSA-N |
| XLogP | 16.70 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.81 |
| LogP ≤ 5 | 16.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |