C54H26F15N3 — CID 146238232
3-[3,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146238232) has the molecular formula C54H26F15N3 and a molecular weight of 1001.79 g/mol. Its IUPAC name is 3-[3,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[3,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146238232 |
| Molecular Formula | C54H26F15N3 |
| Molecular Weight | 1001.79 g/mol |
| Exact Mass | 1001.19 |
| IUPAC Name | 3-[3,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-n3c4ccccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c(C(F)(F)F)c(-n3c4ccccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c2)c1 |
| InChI | InChI=1S/C54H26F15N3/c55-50(56,57)33-14-18-35(41(25-33)52(61,62)63)30-12-16-39-37-8-1-3-10-43(37)71(45(39)21-30)47-23-32(29-7-5-6-28(20-29)27-70)24-48(49(47)54(67,68)69)72-44-11-4-2-9-38(44)40-17-13-31(22-46(40)72)36-19-15-34(51(58,59)60)26-42(36)53(64,65)66/h1-26H |
| InChIKey | XQWMPBYUSORMBO-UHFFFAOYSA-N |
| XLogP | 17.85 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.79 |
| LogP ≤ 5 | 17.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |