C42H18F15N3 — CID 146237861
3-[3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146237861) has the molecular formula C42H18F15N3 and a molecular weight of 849.60 g/mol. Its IUPAC name is 3-[3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146237861 |
| Molecular Formula | C42H18F15N3 |
| Molecular Weight | 849.60 g/mol |
| Exact Mass | 849.13 |
| IUPAC Name | 3-[3,5-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-n3c4ccc(C(F)(F)F)cc4c4cc(C(F)(F)F)ccc43)c(C(F)(F)F)c(-n3c4ccc(C(F)(F)F)cc4c4cc(C(F)(F)F)ccc43)c2)c1 |
| InChI | InChI=1S/C42H18F15N3/c43-38(44,45)23-4-8-31-27(15-23)28-16-24(39(46,47)48)5-9-32(28)59(31)35-13-22(21-3-1-2-20(12-21)19-58)14-36(37(35)42(55,56)57)60-33-10-6-25(40(49,50)51)17-29(33)30-18-26(41(52,53)54)7-11-34(30)60/h1-18H |
| InChIKey | YFYXGXPMTKTBSZ-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.60 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |