C54H54F3N3 — CID 155377995
3-[3,5-bis(2,7-ditert-butylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 155377995) has the molecular formula C54H54F3N3 and a molecular weight of 802.04 g/mol. Its IUPAC name is 3-[3,5-bis(2,7-ditert-butylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[3,5-bis(2,7-ditert-butylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155377995 |
| Molecular Formula | C54H54F3N3 |
| Molecular Weight | 802.04 g/mol |
| Exact Mass | 801.43 |
| IUPAC Name | 3-[3,5-bis(2,7-ditert-butylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc2c3ccc(C(C)(C)C)cc3n(-c3cc(-c4cccc(C#N)c4)cc(-n4c5cc(C(C)(C)C)ccc5c5ccc(C(C)(C)C)cc54)c3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C54H54F3N3/c1-50(2,3)35-16-20-39-40-21-17-36(51(4,5)6)28-44(40)59(43(39)27-35)47-25-34(33-15-13-14-32(24-33)31-58)26-48(49(47)54(55,56)57)60-45-29-37(52(7,8)9)18-22-41(45)42-23-19-38(30-46(42)60)53(10,11)12/h13-30H,1-12H3 |
| InChIKey | MOJGSTCMCMAJNR-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.04 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |