C46H38N4 — CID 146238034
4,5-bis(2-tert-butylcarbazol-9-yl)-2-(3-cyanophenyl)benzonitrile (PubChem CID 146238034) has the molecular formula C46H38N4 and a molecular weight of 646.84 g/mol. Its IUPAC name is 4,5-bis(2-tert-butylcarbazol-9-yl)-2-(3-cyanophenyl)benzonitrile.
| Compound Name | 4,5-bis(2-tert-butylcarbazol-9-yl)-2-(3-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 146238034 |
| Molecular Formula | C46H38N4 |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 4,5-bis(2-tert-butylcarbazol-9-yl)-2-(3-cyanophenyl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c3ccccc3n(-c3cc(C#N)c(-c4cccc(C#N)c4)cc3-n3c4ccccc4c4ccc(C(C)(C)C)cc43)c2c1 |
| InChI | InChI=1S/C46H38N4/c1-45(2,3)32-18-20-36-34-14-7-9-16-39(34)49(41(36)24-32)43-23-31(28-48)38(30-13-11-12-29(22-30)27-47)26-44(43)50-40-17-10-8-15-35(40)37-21-19-33(25-42(37)50)46(4,5)6/h7-26H,1-6H3 |
| InChIKey | CCJJREPQRNGVGV-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |