C74H54N8 — CID 169035944
3-[3-[4,6-bis[2-(3-tert-butylcarbazol-9-yl)-4-(3-cyanophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 169035944) has the molecular formula C74H54N8 and a molecular weight of 1055.30 g/mol. Its IUPAC name is 3-[3-[4,6-bis[2-(3-tert-butylcarbazol-9-yl)-4-(3-cyanophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 3-[3-[4,6-bis[2-(3-tert-butylcarbazol-9-yl)-4-(3-cyanophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 169035944 |
| Molecular Formula | C74H54N8 |
| Molecular Weight | 1055.30 g/mol |
| Exact Mass | 1054.45 |
| IUPAC Name | 3-[3-[4,6-bis[2-(3-tert-butylcarbazol-9-yl)-4-(3-cyanophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccccc1n2-c1cc(-c2cccc(C#N)c2)ccc1-c1nc(-c2cccc(-c3cccc(C#N)c3)c2)nc(-c2ccc(-c3cccc(C#N)c3)cc2-n2c3ccccc3c3cc(C(C)(C)C)ccc32)n1 |
| InChI | InChI=1S/C74H54N8/c1-73(2,3)56-29-33-66-62(41-56)58-23-7-9-25-64(58)81(66)68-39-53(50-19-12-16-47(36-50)44-76)27-31-60(68)71-78-70(55-22-14-21-52(38-55)49-18-11-15-46(35-49)43-75)79-72(80-71)61-32-28-54(51-20-13-17-48(37-51)45-77)40-69(61)82-65-26-10-8-24-59(65)63-42-57(74(4,5)6)30-34-67(63)82/h7-42H,1-6H3 |
| InChIKey | JCCDXXTUMPCMDH-UHFFFAOYSA-N |
| XLogP | 18.28 |
| TPSA | 119.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.30 |
| LogP ≤ 5 | 18.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |