C78H46N8 — CID 169035606
3-[3-[4,6-bis[4-(3-cyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 169035606) has the molecular formula C78H46N8 and a molecular weight of 1095.28 g/mol. Its IUPAC name is 3-[3-[4,6-bis[4-(3-cyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 3-[3-[4,6-bis[4-(3-cyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 169035606 |
| Molecular Formula | C78H46N8 |
| Molecular Weight | 1095.28 g/mol |
| Exact Mass | 1094.38 |
| IUPAC Name | 3-[3-[4,6-bis[4-(3-cyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc(-c3nc(-c4ccc(-c5cccc(C#N)c5)cc4-n4c5ccccc5c5cc(-c6ccccc6)ccc54)nc(-c4ccc(-c5cccc(C#N)c5)cc4-n4c5ccccc5c5cc(-c6ccccc6)ccc54)n3)c2)c1 |
| InChI | InChI=1S/C78H46N8/c79-47-50-15-11-22-55(39-50)58-25-14-26-63(42-58)76-82-77(66-35-31-61(56-23-12-16-51(40-56)48-80)45-74(66)85-70-29-9-7-27-64(70)68-43-59(33-37-72(68)85)53-18-3-1-4-19-53)84-78(83-76)67-36-32-62(57-24-13-17-52(41-57)49-81)46-75(67)86-71-30-10-8-28-65(71)69-44-60(34-38-73(69)86)54-20-5-2-6-21-54/h1-46H |
| InChIKey | AKWKWJJKWQWAFF-UHFFFAOYSA-N |
| XLogP | 19.02 |
| TPSA | 119.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.28 |
| LogP ≤ 5 | 19.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |