C40H25N5 — CID 134476139
4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-phenylcarbazol-9-yl)benzonitrile (PubChem CID 134476139) has the molecular formula C40H25N5 and a molecular weight of 575.68 g/mol. Its IUPAC name is 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-phenylcarbazol-9-yl)benzonitrile.
| Compound Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-phenylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 134476139 |
| Molecular Formula | C40H25N5 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-phenylcarbazol-9-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-n2c3ccccc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C40H25N5/c41-26-27-20-22-33(40-43-38(29-14-6-2-7-15-29)42-39(44-40)30-16-8-3-9-17-30)37(24-27)45-35-19-11-10-18-32(35)34-25-31(21-23-36(34)45)28-12-4-1-5-13-28/h1-25H |
| InChIKey | FTPGVPHIOBYJFW-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |