C47H30N4 — CID 155014674
3-(3,6-diphenylcarbazol-9-yl)-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile (PubChem CID 155014674) has the molecular formula C47H30N4 and a molecular weight of 650.79 g/mol. Its IUPAC name is 3-(3,6-diphenylcarbazol-9-yl)-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile.
| Compound Name | 3-(3,6-diphenylcarbazol-9-yl)-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 155014674 |
| Molecular Formula | C47H30N4 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 3-(3,6-diphenylcarbazol-9-yl)-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C47H30N4/c48-31-32-21-24-39(47-49-42(35-17-9-3-10-18-35)30-43(50-47)36-19-11-4-12-20-36)46(27-32)51-44-25-22-37(33-13-5-1-6-14-33)28-40(44)41-29-38(23-26-45(41)51)34-15-7-2-8-16-34/h1-30H |
| InChIKey | BGDJCWBZWLVKMN-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |