C75H41N9 — CID 147296748
3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile (PubChem CID 147296748) has the molecular formula C75H41N9 and a molecular weight of 1068.22 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile.
| Compound Name | 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 147296748 |
| Molecular Formula | C75H41N9 |
| Molecular Weight | 1068.22 g/mol |
| Exact Mass | 1067.35 |
| IUPAC Name | 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4)ccc2n3-c2cc(C#N)cc(-n3c4ccc(-c5ccc(C#N)cc5)cc4c4cc(-c5ccc(C#N)cc5)ccc43)c2-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C75H41N9/c76-42-47-11-19-52(20-12-47)58-27-31-68-62(37-58)63-38-59(53-21-13-48(43-77)14-22-53)28-32-69(63)83(68)72-35-51(46-80)36-73(74(72)75-81-66(56-7-3-1-4-8-56)41-67(82-75)57-9-5-2-6-10-57)84-70-33-29-60(54-23-15-49(44-78)16-24-54)39-64(70)65-40-61(30-34-71(65)84)55-25-17-50(45-79)18-26-55/h1-41H |
| InChIKey | CVGQSMCHZZFBBU-UHFFFAOYSA-N |
| XLogP | 17.70 |
| TPSA | 154.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1068.22 |
| LogP ≤ 5 | 17.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |