C74H40N10 — CID 134321349
3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 134321349) has the molecular formula C74H40N10 and a molecular weight of 1069.20 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134321349 |
| Molecular Formula | C74H40N10 |
| Molecular Weight | 1069.20 g/mol |
| Exact Mass | 1068.34 |
| IUPAC Name | 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4)ccc2n3-c2cc(C#N)cc(-n3c4ccc(-c5ccc(C#N)cc5)cc4c4cc(-c5ccc(C#N)cc5)ccc43)c2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C74H40N10/c75-41-46-11-19-51(20-12-46)57-27-31-65-61(37-57)62-38-58(52-21-13-47(42-76)14-22-52)28-32-66(62)83(65)69-35-50(45-79)36-70(71(69)74-81-72(55-7-3-1-4-8-55)80-73(82-74)56-9-5-2-6-10-56)84-67-33-29-59(53-23-15-48(43-77)16-24-53)39-63(67)64-40-60(30-34-68(64)84)54-25-17-49(44-78)18-26-54/h1-40H |
| InChIKey | SSZMXFYKKOOSKT-UHFFFAOYSA-N |
| XLogP | 17.09 |
| TPSA | 167.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.20 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |