C48H27N7 — CID 134476269
2-[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 134476269) has the molecular formula C48H27N7 and a molecular weight of 701.79 g/mol. Its IUPAC name is 2-[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 2-[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134476269 |
| Molecular Formula | C48H27N7 |
| Molecular Weight | 701.79 g/mol |
| Exact Mass | 701.23 |
| IUPAC Name | 2-[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4)ccc2n3-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2C#N)cc1 |
| InChI | InChI=1S/C48H27N7/c49-28-31-11-15-33(16-12-31)37-21-23-43-41(25-37)42-26-38(34-17-13-32(29-50)14-18-34)22-24-44(42)55(43)45-27-39(19-20-40(45)30-51)48-53-46(35-7-3-1-4-8-35)52-47(54-48)36-9-5-2-6-10-36/h1-27H |
| InChIKey | QLJSYJFCIDUMGE-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 114.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.79 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |