C46H29N5 — CID 118152758
6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole-3-carbonitrile (PubChem CID 118152758) has the molecular formula C46H29N5 and a molecular weight of 651.77 g/mol. Its IUPAC name is 6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole-3-carbonitrile.
| Compound Name | 6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 118152758 |
| Molecular Formula | C46H29N5 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | 6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1cc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C46H29N5/c47-30-31-16-26-42-40(28-31)41-29-38(25-27-43(41)51(42)39-14-8-3-9-15-39)46-49-44(36-21-17-34(18-22-36)32-10-4-1-5-11-32)48-45(50-46)37-23-19-35(20-24-37)33-12-6-2-7-13-33/h1-29H |
| InChIKey | WAQZYKULGIIPGF-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |