C52H33N5 — CID 118152961
6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-(4-phenylphenyl)carbazole-3-carbonitrile (PubChem CID 118152961) has the molecular formula C52H33N5 and a molecular weight of 727.87 g/mol. Its IUPAC name is 6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-(4-phenylphenyl)carbazole-3-carbonitrile.
| Compound Name | 6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-(4-phenylphenyl)carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 118152961 |
| Molecular Formula | C52H33N5 |
| Molecular Weight | 727.87 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | 6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-9-(4-phenylphenyl)carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1cc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)ccc1n2-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C52H33N5/c53-34-35-16-30-48-46(32-35)47-33-44(27-31-49(47)57(48)45-28-25-41(26-29-45)38-14-8-3-9-15-38)52-55-50(42-21-17-39(18-22-42)36-10-4-1-5-11-36)54-51(56-52)43-23-19-40(20-24-43)37-12-6-2-7-13-37/h1-33H |
| InChIKey | NSOFDSUEGOWBQY-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.87 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |