C41H24N6 — CID 134512928
2-[3-(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 134512928) has the molecular formula C41H24N6 and a molecular weight of 600.69 g/mol. Its IUPAC name is 2-[3-(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 2-[3-(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134512928 |
| Molecular Formula | C41H24N6 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 2-[3-(4-cyanophenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2C#N)cc1 |
| InChI | InChI=1S/C41H24N6/c42-25-27-15-17-28(18-16-27)31-21-22-37-35(23-31)34-13-7-8-14-36(34)47(37)38-24-32(19-20-33(38)26-43)41-45-39(29-9-3-1-4-10-29)44-40(46-41)30-11-5-2-6-12-30/h1-24H |
| InChIKey | ISNLRJISGLWMDB-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 91.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |