C60H37N5 — CID 155446971
4-[3-(4-cyanophenyl)-2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]benzonitrile (PubChem CID 155446971) has the molecular formula C60H37N5 and a molecular weight of 827.99 g/mol. Its IUPAC name is 4-[3-(4-cyanophenyl)-2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]benzonitrile.
| Compound Name | 4-[3-(4-cyanophenyl)-2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155446971 |
| Molecular Formula | C60H37N5 |
| Molecular Weight | 827.99 g/mol |
| Exact Mass | 827.30 |
| IUPAC Name | 4-[3-(4-cyanophenyl)-2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc(-c3ccc(C#N)cc3)c2-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C60H37N5/c61-38-40-21-25-44(26-22-40)51-35-50(60-63-55(46-17-9-3-10-18-46)37-56(64-60)47-19-11-4-12-20-47)36-52(45-27-23-41(39-62)24-28-45)59(51)65-57-31-29-48(42-13-5-1-6-14-42)33-53(57)54-34-49(30-32-58(54)65)43-15-7-2-8-16-43/h1-37H |
| InChIKey | HBSFTVRRFZFHBC-UHFFFAOYSA-N |
| XLogP | 14.99 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.99 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |