C70H38N8 — CID 155216592
2,6-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(6-phenyl-2-pyridinyl)benzonitrile (PubChem CID 155216592) has the molecular formula C70H38N8 and a molecular weight of 991.13 g/mol. Its IUPAC name is 2,6-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(6-phenyl-2-pyridinyl)benzonitrile.
| Compound Name | 2,6-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(6-phenyl-2-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 155216592 |
| Molecular Formula | C70H38N8 |
| Molecular Weight | 991.13 g/mol |
| Exact Mass | 990.32 |
| IUPAC Name | 2,6-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-(6-phenyl-2-pyridinyl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4)ccc2n3-c2cc(-c3cccc(-c4ccccc4)n3)cc(-n3c4ccc(-c5ccc(C#N)cc5)cc4c4cc(-c5ccc(C#N)cc5)ccc43)c2C#N)cc1 |
| InChI | InChI=1S/C70H38N8/c71-39-44-9-17-48(18-10-44)53-25-29-65-58(33-53)59-34-54(49-19-11-45(40-72)12-20-49)26-30-66(59)77(65)69-37-57(64-8-4-7-63(76-64)52-5-2-1-3-6-52)38-70(62(69)43-75)78-67-31-27-55(50-21-13-46(41-73)14-22-50)35-60(67)61-36-56(28-32-68(61)78)51-23-15-47(42-74)16-24-51/h1-38H |
| InChIKey | PULYEZSXUVXRMH-UHFFFAOYSA-N |
| XLogP | 16.64 |
| TPSA | 141.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.13 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |