C82H50N8 — CID 155377637
2,6-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile (PubChem CID 155377637) has the molecular formula C82H50N8 and a molecular weight of 1147.36 g/mol. Its IUPAC name is 2,6-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile.
| Compound Name | 2,6-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 155377637 |
| Molecular Formula | C82H50N8 |
| Molecular Weight | 1147.36 g/mol |
| Exact Mass | 1146.42 |
| IUPAC Name | 2,6-bis[2,7-bis(6-phenyl-2-pyridinyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-n3c4cc(-c5cccc(-c6ccccc6)n5)ccc4c4ccc(-c5cccc(-c6ccccc6)n5)cc43)c(C#N)c(-n3c4cc(-c5cccc(-c6ccccc6)n5)ccc4c4ccc(-c5cccc(-c6ccccc6)n5)cc43)c2)c1 |
| InChI | InChI=1S/C82H50N8/c83-51-53-18-13-27-58(44-53)63-49-81(89-77-45-59(73-32-14-28-69(85-73)54-19-5-1-6-20-54)36-40-64(77)65-41-37-60(46-78(65)89)74-33-15-29-70(86-74)55-21-7-2-8-22-55)68(52-84)82(50-63)90-79-47-61(75-34-16-30-71(87-75)56-23-9-3-10-24-56)38-42-66(79)67-43-39-62(48-80(67)90)76-35-17-31-72(88-76)57-25-11-4-12-26-57/h1-50H |
| InChIKey | YXKQGGLPQPAACY-UHFFFAOYSA-N |
| XLogP | 20.21 |
| TPSA | 109.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.36 |
| LogP ≤ 5 | 20.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |