C82H70N8 — CID 170134056
2-[2-[4,6-bis[4-(3-cyanophenyl)-2-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 170134056) has the molecular formula C82H70N8 and a molecular weight of 1167.52 g/mol. Its IUPAC name is 2-[2-[4,6-bis[4-(3-cyanophenyl)-2-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 2-[2-[4,6-bis[4-(3-cyanophenyl)-2-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170134056 |
| Molecular Formula | C82H70N8 |
| Molecular Weight | 1167.52 g/mol |
| Exact Mass | 1166.57 |
| IUPAC Name | 2-[2-[4,6-bis[4-(3-cyanophenyl)-2-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(-c2cccc(C#N)c2)ccc1-c1nc(-c2ccccc2-c2ccccc2C#N)nc(-c2ccc(-c3cccc(C#N)c3)cc2-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)n1 |
| InChI | InChI=1S/C82H70N8/c1-79(2,3)57-29-35-70-66(43-57)67-44-58(80(4,5)6)30-36-71(67)89(70)74-41-54(52-22-17-19-50(39-52)47-83)27-33-64(74)77-86-76(63-26-16-15-25-62(63)61-24-14-13-21-56(61)49-85)87-78(88-77)65-34-28-55(53-23-18-20-51(40-53)48-84)42-75(65)90-72-37-31-59(81(7,8)9)45-68(72)69-46-60(82(10,11)12)32-38-73(69)90/h13-46H,1-12H3 |
| InChIKey | HOGPBJPASCWOQR-UHFFFAOYSA-N |
| XLogP | 20.87 |
| TPSA | 119.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.52 |
| LogP ≤ 5 | 20.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |