C52H28N6 — CID 155377782
2-(3-cyanophenyl)-4,5-bis[3-(2-cyanophenyl)carbazol-9-yl]benzonitrile (PubChem CID 155377782) has the molecular formula C52H28N6 and a molecular weight of 736.84 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-4,5-bis[3-(2-cyanophenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 2-(3-cyanophenyl)-4,5-bis[3-(2-cyanophenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 155377782 |
| Molecular Formula | C52H28N6 |
| Molecular Weight | 736.84 g/mol |
| Exact Mass | 736.24 |
| IUPAC Name | 2-(3-cyanophenyl)-4,5-bis[3-(2-cyanophenyl)carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-n3c4ccccc4c4cc(-c5ccccc5C#N)ccc43)c(-n3c4ccccc4c4cc(-c5ccccc5C#N)ccc43)cc2C#N)c1 |
| InChI | InChI=1S/C52H28N6/c53-29-33-10-9-13-34(24-33)44-28-52(58-48-19-8-6-17-43(48)46-26-36(21-23-50(46)58)41-15-4-2-12-38(41)31-55)51(27-39(44)32-56)57-47-18-7-5-16-42(47)45-25-35(20-22-49(45)57)40-14-3-1-11-37(40)30-54/h1-28H |
| InChIKey | NFXXQDHDJMJPEU-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.84 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |