C53H30F3N5 — CID 139562714
4,5-bis[3-(3-cyanophenyl)carbazol-9-yl]-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 139562714) has the molecular formula C53H30F3N5 and a molecular weight of 793.85 g/mol. Its IUPAC name is 4,5-bis[3-(3-cyanophenyl)carbazol-9-yl]-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4,5-bis[3-(3-cyanophenyl)carbazol-9-yl]-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139562714 |
| Molecular Formula | C53H30F3N5 |
| Molecular Weight | 793.85 g/mol |
| Exact Mass | 793.25 |
| IUPAC Name | 4,5-bis[3-(3-cyanophenyl)carbazol-9-yl]-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(-c2cc(-n3c4ccccc4c4cc(-c5cccc(C#N)c5)ccc43)c(-n3c4ccccc4c4cc(-c5cccc(C#N)c5)ccc43)cc2C#N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C53H30F3N5/c1-32-20-39(24-41(21-32)53(54,55)56)44-28-52(61-48-15-5-3-13-43(48)46-26-38(17-19-50(46)61)36-11-7-9-34(23-36)30-58)51(27-40(44)31-59)60-47-14-4-2-12-42(47)45-25-37(16-18-49(45)60)35-10-6-8-33(22-35)29-57/h2-28H,1H3 |
| InChIKey | MGIUENDKWHAPNI-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.85 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |