C55H34F6N4 — CID 159351324
4-(3-cyano-5-methylphenyl)-2,5-bis[2-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile (PubChem CID 159351324) has the molecular formula C55H34F6N4 and a molecular weight of 864.89 g/mol. Its IUPAC name is 4-(3-cyano-5-methylphenyl)-2,5-bis[2-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile.
| Compound Name | 4-(3-cyano-5-methylphenyl)-2,5-bis[2-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 159351324 |
| Molecular Formula | C55H34F6N4 |
| Molecular Weight | 864.89 g/mol |
| Exact Mass | 864.27 |
| IUPAC Name | 4-(3-cyano-5-methylphenyl)-2,5-bis[2-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C#N)cc(-c2cc(-n3c4ccccc4c4ccc(-c5cc(C)cc(C(F)(F)F)c5)cc43)c(C#N)cc2-n2c3ccccc3c3ccc(-c4cc(C)cc(C(F)(F)F)c4)cc32)c1 |
| InChI | InChI=1S/C55H34F6N4/c1-31-16-34(29-62)22-39(19-31)47-28-50(64-48-10-6-4-8-43(48)45-14-12-35(25-51(45)64)37-17-32(2)20-41(23-37)54(56,57)58)40(30-63)27-53(47)65-49-11-7-5-9-44(49)46-15-13-36(26-52(46)65)38-18-33(3)21-42(24-38)55(59,60)61/h4-28H,1-3H3 |
| InChIKey | WZWCGUUKYMZROV-UHFFFAOYSA-N |
| XLogP | 15.59 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.89 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |