C63H37F6N3 — CID 134287516
2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-diphenylcarbazol-9-yl)benzonitrile (PubChem CID 134287516) has the molecular formula C63H37F6N3 and a molecular weight of 950.00 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-diphenylcarbazol-9-yl)benzonitrile.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-diphenylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 134287516 |
| Molecular Formula | C63H37F6N3 |
| Molecular Weight | 950.00 g/mol |
| Exact Mass | 949.29 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-diphenylcarbazol-9-yl)benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C63H37F6N3/c64-62(65,66)49-29-47(30-50(36-49)63(67,68)69)51-37-61(72-58-27-23-45(41-17-9-3-10-18-41)33-54(58)55-34-46(24-28-59(55)72)42-19-11-4-12-20-42)60(35-48(51)38-70)71-56-25-21-43(39-13-5-1-6-14-39)31-52(56)53-32-44(22-26-57(53)71)40-15-7-2-8-16-40/h1-37H |
| InChIKey | JVLLGTDWWJJSAA-UHFFFAOYSA-N |
| XLogP | 18.13 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.00 |
| LogP ≤ 5 | 18.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |