C55H53F6N3 — CID 134287528
2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-ditert-butylcarbazol-9-yl)benzonitrile (PubChem CID 134287528) has the molecular formula C55H53F6N3 and a molecular weight of 870.04 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-ditert-butylcarbazol-9-yl)benzonitrile.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-ditert-butylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 134287528 |
| Molecular Formula | C55H53F6N3 |
| Molecular Weight | 870.04 g/mol |
| Exact Mass | 869.41 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-ditert-butylcarbazol-9-yl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(C#N)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1-n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C55H53F6N3/c1-50(2,3)33-13-17-44-40(25-33)41-26-34(51(4,5)6)14-18-45(41)63(44)48-23-32(30-62)39(31-21-37(54(56,57)58)24-38(22-31)55(59,60)61)29-49(48)64-46-19-15-35(52(7,8)9)27-42(46)43-28-36(53(10,11)12)16-20-47(43)64/h13-29H,1-12H3 |
| InChIKey | GGBRBIHODZTTFT-UHFFFAOYSA-N |
| XLogP | 16.65 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.04 |
| LogP ≤ 5 | 16.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |