C55H56F3N3 — CID 134295751
4,5-bis(2,7-ditert-butylcarbazol-9-yl)-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 134295751) has the molecular formula C55H56F3N3 and a molecular weight of 816.07 g/mol. Its IUPAC name is 4,5-bis(2,7-ditert-butylcarbazol-9-yl)-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4,5-bis(2,7-ditert-butylcarbazol-9-yl)-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 134295751 |
| Molecular Formula | C55H56F3N3 |
| Molecular Weight | 816.07 g/mol |
| Exact Mass | 815.44 |
| IUPAC Name | 4,5-bis(2,7-ditert-butylcarbazol-9-yl)-2-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(-c2cc(-n3c4cc(C(C)(C)C)ccc4c4ccc(C(C)(C)C)cc43)c(-n3c4cc(C(C)(C)C)ccc4c4ccc(C(C)(C)C)cc43)cc2C#N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C55H56F3N3/c1-32-22-33(24-39(23-32)55(56,57)58)44-30-50(61-47-28-37(53(8,9)10)16-20-42(47)43-21-17-38(29-48(43)61)54(11,12)13)49(25-34(44)31-59)60-45-26-35(51(2,3)4)14-18-40(45)41-19-15-36(27-46(41)60)52(5,6)7/h14-30H,1-13H3 |
| InChIKey | QJTPKULRRHOKJP-UHFFFAOYSA-N |
| XLogP | 15.94 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.07 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |