C75H61F3N4 — CID 155427412
4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-[3-cyano-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 155427412) has the molecular formula C75H61F3N4 and a molecular weight of 1075.33 g/mol. Its IUPAC name is 4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-[3-cyano-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-[3-cyano-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155427412 |
| Molecular Formula | C75H61F3N4 |
| Molecular Weight | 1075.33 g/mol |
| Exact Mass | 1074.48 |
| IUPAC Name | 4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-[3-cyano-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccc(-c5c(C)cc(C)cc5C)cc4n(-c4cc(C#N)c(-c5cc(C#N)cc(C(F)(F)F)c5)cc4-n4c5cc(-c6c(C)cc(C)cc6C)ccc5c5ccc(-c6c(C)cc(C)cc6C)cc54)c3c2)c(C)c1 |
| InChI | InChI=1S/C75H61F3N4/c1-40-21-44(5)71(45(6)22-40)53-13-17-60-61-18-14-54(72-46(7)23-41(2)24-47(72)8)33-66(61)81(65(60)32-53)69-36-58(39-80)64(57-29-52(38-79)30-59(31-57)75(76,77)78)37-70(69)82-67-34-55(73-48(9)25-42(3)26-49(73)10)15-19-62(67)63-20-16-56(35-68(63)82)74-50(11)27-43(4)28-51(74)12/h13-37H,1-12H3 |
| InChIKey | SHKWXCQHAIOSMT-UHFFFAOYSA-N |
| XLogP | 20.68 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.33 |
| LogP ≤ 5 | 20.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |