C72H62N4 — CID 134296295
4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile (PubChem CID 134296295) has the molecular formula C72H62N4 and a molecular weight of 983.32 g/mol. Its IUPAC name is 4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile.
| Compound Name | 4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 134296295 |
| Molecular Formula | C72H62N4 |
| Molecular Weight | 983.32 g/mol |
| Exact Mass | 982.50 |
| IUPAC Name | 4,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccc(-c5c(C)cc(C)cc5C)cc4n(-c4cc(C#N)c(-c5ccncc5)cc4-n4c5cc(-c6c(C)cc(C)cc6C)ccc5c5ccc(-c6c(C)cc(C)cc6C)cc54)c3c2)c(C)c1 |
| InChI | InChI=1S/C72H62N4/c1-40-25-44(5)69(45(6)26-40)53-13-17-58-59-18-14-54(70-46(7)27-41(2)28-47(70)8)34-64(59)75(63(58)33-53)67-37-57(39-73)62(52-21-23-74-24-22-52)38-68(67)76-65-35-55(71-48(9)29-42(3)30-49(71)10)15-19-60(65)61-20-16-56(36-66(61)76)72-50(11)31-43(4)32-51(72)12/h13-38H,1-12H3 |
| InChIKey | GQUPQLGXRCSIOX-UHFFFAOYSA-N |
| XLogP | 19.18 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.32 |
| LogP ≤ 5 | 19.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |