C64H46N4 — CID 134302157
4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile (PubChem CID 134302157) has the molecular formula C64H46N4 and a molecular weight of 871.10 g/mol. Its IUPAC name is 4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile.
| Compound Name | 4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 134302157 |
| Molecular Formula | C64H46N4 |
| Molecular Weight | 871.10 g/mol |
| Exact Mass | 870.37 |
| IUPAC Name | 4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccc(-c5ccc(C)cc5)cc4n(-c4cc(C#N)c(-c5ccncc5)cc4-n4c5cc(-c6ccc(C)cc6)ccc5c5ccc(-c6ccc(C)cc6)cc54)c3c2)cc1 |
| InChI | InChI=1S/C64H46N4/c1-40-5-13-44(14-6-40)49-21-25-54-55-26-22-50(45-15-7-41(2)8-16-45)34-60(55)67(59(54)33-49)63-37-53(39-65)58(48-29-31-66-32-30-48)38-64(63)68-61-35-51(46-17-9-42(3)10-18-46)23-27-56(61)57-28-24-52(36-62(57)68)47-19-11-43(4)12-20-47/h5-38H,1-4H3 |
| InChIKey | NNUXSONVKSVYIA-UHFFFAOYSA-N |
| XLogP | 16.72 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.10 |
| LogP ≤ 5 | 16.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |