C32H23N3 — CID 138566079
5-methyl-4-[3-(3-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile (PubChem CID 138566079) has the molecular formula C32H23N3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 5-methyl-4-[3-(3-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile.
| Compound Name | 5-methyl-4-[3-(3-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 138566079 |
| Molecular Formula | C32H23N3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 5-methyl-4-[3-(3-methylphenyl)carbazol-9-yl]-2-pyridin-4-ylbenzonitrile |
| SMILES | Cc1cccc(-c2ccc3c(c2)c2ccccc2n3-c2cc(-c3ccncc3)c(C#N)cc2C)c1 |
| InChI | InChI=1S/C32H23N3/c1-21-6-5-7-24(16-21)25-10-11-31-29(18-25)27-8-3-4-9-30(27)35(31)32-19-28(23-12-14-34-15-13-23)26(20-33)17-22(32)2/h3-19H,1-2H3 |
| InChIKey | WMXQSLFBBIQCOQ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |