C41H33N3 — CID 138565580
5-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-methyl-2-pyridin-4-ylbenzonitrile (PubChem CID 138565580) has the molecular formula C41H33N3 and a molecular weight of 567.74 g/mol. Its IUPAC name is 5-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-methyl-2-pyridin-4-ylbenzonitrile.
| Compound Name | 5-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-methyl-2-pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 138565580 |
| Molecular Formula | C41H33N3 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 5-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-methyl-2-pyridin-4-ylbenzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccc(-c5ccc(C)cc5C)cc4n(-c4cc(C#N)c(-c5ccncc5)cc4C)c3c2)c(C)c1 |
| InChI | InChI=1S/C41H33N3/c1-25-6-10-34(27(3)18-25)31-8-12-36-37-13-9-32(35-11-7-26(2)19-28(35)4)22-41(37)44(40(36)21-31)39-23-33(24-42)38(20-29(39)5)30-14-16-43-17-15-30/h6-23H,1-5H3 |
| InChIKey | AQEHWPKKJAFRSJ-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |