C68H54N4 — CID 153494743
9-[2-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-pyridin-4-ylphenyl]-2,7-bis(2,4-dimethylphenyl)carbazole (PubChem CID 153494743) has the molecular formula C68H54N4 and a molecular weight of 927.21 g/mol. Its IUPAC name is 9-[2-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-pyridin-4-ylphenyl]-2,7-bis(2,4-dimethylphenyl)carbazole.
| Compound Name | 9-[2-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-pyridin-4-ylphenyl]-2,7-bis(2,4-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 153494743 |
| Molecular Formula | C68H54N4 |
| Molecular Weight | 927.21 g/mol |
| Exact Mass | 926.43 |
| IUPAC Name | 9-[2-[2,7-bis(2,4-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-pyridin-4-ylphenyl]-2,7-bis(2,4-dimethylphenyl)carbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3cc(-c4ccc(C)cc4C)ccc3c3ccc(-c4ccc(C)cc4C)cc32)c(-n2c3cc(-c4ccc(C)cc4C)ccc3c3ccc(-c4ccc(C)cc4C)cc32)cc1-c1ccncc1 |
| InChI | InChI=1S/C68H54N4/c1-40-10-18-53(44(5)30-40)49-14-22-57-58-23-15-50(54-19-11-41(2)31-45(54)6)35-64(58)71(63(57)34-49)67-38-61(48-26-28-70-29-27-48)62(69-9)39-68(67)72-65-36-51(55-20-12-42(3)32-46(55)7)16-24-59(65)60-25-17-52(37-66(60)72)56-21-13-43(4)33-47(56)8/h10-39H,1-8H3 |
| InChIKey | BHRIDLGWICIUEG-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 27.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.21 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|