C67H48N4 — CID 161252302
2-[4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-isocyanophenyl]-5-methylbenzonitrile (PubChem CID 161252302) has the molecular formula C67H48N4 and a molecular weight of 909.15 g/mol. Its IUPAC name is 2-[4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-isocyanophenyl]-5-methylbenzonitrile.
| Compound Name | 2-[4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-isocyanophenyl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 161252302 |
| Molecular Formula | C67H48N4 |
| Molecular Weight | 909.15 g/mol |
| Exact Mass | 908.39 |
| IUPAC Name | 2-[4,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-2-isocyanophenyl]-5-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3cc(-c4ccc(C)cc4)ccc3c3ccc(-c4ccc(C)cc4)cc32)c(-n2c3cc(-c4ccc(C)cc4)ccc3c3ccc(-c4ccc(C)cc4)cc32)cc1-c1ccc(C)cc1C#N |
| InChI | InChI=1S/C67H48N4/c1-41-7-16-46(17-8-41)50-24-29-56-57-30-25-51(47-18-9-42(2)10-19-47)35-63(57)70(62(56)34-50)66-38-60(55-28-15-45(5)33-54(55)40-68)61(69-6)39-67(66)71-64-36-52(48-20-11-43(3)12-21-48)26-31-58(64)59-32-27-53(37-65(59)71)49-22-13-44(4)14-23-49/h7-39H,1-5H3 |
| InChIKey | SVDQSCPRLVBNAW-UHFFFAOYSA-N |
| XLogP | 18.18 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.15 |
| LogP ≤ 5 | 18.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|