C40H30N4 — CID 140846679
9-[2-(2,7-dimethylcarbazol-9-yl)-4-isocyano-5-pyridin-4-ylphenyl]-2,7-dimethylcarbazole (PubChem CID 140846679) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is 9-[2-(2,7-dimethylcarbazol-9-yl)-4-isocyano-5-pyridin-4-ylphenyl]-2,7-dimethylcarbazole.
| Compound Name | 9-[2-(2,7-dimethylcarbazol-9-yl)-4-isocyano-5-pyridin-4-ylphenyl]-2,7-dimethylcarbazole |
|---|---|
| PubChem CID | 140846679 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 9-[2-(2,7-dimethylcarbazol-9-yl)-4-isocyano-5-pyridin-4-ylphenyl]-2,7-dimethylcarbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3cc(C)ccc3c3ccc(C)cc32)c(-n2c3cc(C)ccc3c3ccc(C)cc32)cc1-c1ccncc1 |
| InChI | InChI=1S/C40H30N4/c1-24-6-10-29-30-11-7-25(2)19-36(30)43(35(29)18-24)39-22-33(28-14-16-42-17-15-28)34(41-5)23-40(39)44-37-20-26(3)8-12-31(37)32-13-9-27(4)21-38(32)44/h6-23H,1-4H3 |
| InChIKey | XSCGTWPFOBAZBJ-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 27.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|