C56H46N4 — CID 134296333
4-(2,6-dimethyl-4-pyridinyl)-2,5-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 134296333) has the molecular formula C56H46N4 and a molecular weight of 775.01 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-pyridinyl)-2,5-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-(2,6-dimethyl-4-pyridinyl)-2,5-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134296333 |
| Molecular Formula | C56H46N4 |
| Molecular Weight | 775.01 g/mol |
| Exact Mass | 774.37 |
| IUPAC Name | 4-(2,6-dimethyl-4-pyridinyl)-2,5-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccccc4n(-c4cc(-c5cc(C)nc(C)c5)c(-n5c6ccccc6c6ccc(-c7c(C)cc(C)cc7C)cc65)cc4C#N)c3c2)c(C)c1 |
| InChI | InChI=1S/C56H46N4/c1-32-21-34(3)55(35(4)22-32)40-17-19-46-44-13-9-11-15-49(44)59(52(46)27-40)51-30-48(42-25-38(7)58-39(8)26-42)54(29-43(51)31-57)60-50-16-12-10-14-45(50)47-20-18-41(28-53(47)60)56-36(5)23-33(2)24-37(56)6/h9-30H,1-8H3 |
| InChIKey | IVOFNBJRPYZFRI-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.01 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |