C57H41N5 — CID 139538740
5-[4-cyano-2,6-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile (PubChem CID 139538740) has the molecular formula C57H41N5 and a molecular weight of 795.99 g/mol. Its IUPAC name is 5-[4-cyano-2,6-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-cyano-2,6-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139538740 |
| Molecular Formula | C57H41N5 |
| Molecular Weight | 795.99 g/mol |
| Exact Mass | 795.34 |
| IUPAC Name | 5-[4-cyano-2,6-bis[2-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccccc4n(-c4cc(C#N)cc(-n5c6ccccc6c6ccc(-c7c(C)cc(C)cc7C)cc65)c4-c4cc(C#N)cc(C#N)c4)c3c2)c(C)c1 |
| InChI | InChI=1S/C57H41N5/c1-33-19-35(3)55(36(4)20-33)42-15-17-47-45-11-7-9-13-49(45)61(51(47)28-42)53-26-41(32-60)27-54(57(53)44-24-39(30-58)23-40(25-44)31-59)62-50-14-10-8-12-46(50)48-18-16-43(29-52(48)62)56-37(5)21-34(2)22-38(56)6/h7-29H,1-6H3 |
| InChIKey | BIXUGGVWQGNDTB-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.99 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |