C55H37F6N3 — CID 134300530
4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[3-(3,5-dimethylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 134300530) has the molecular formula C55H37F6N3 and a molecular weight of 853.91 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[3-(3,5-dimethylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[3-(3,5-dimethylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134300530 |
| Molecular Formula | C55H37F6N3 |
| Molecular Weight | 853.91 g/mol |
| Exact Mass | 853.29 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[3-(3,5-dimethylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2ccccc2n3-c2cc(C#N)cc(-n3c4ccccc4c4cc(-c5cc(C)cc(C)c5)ccc43)c2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C55H37F6N3/c1-31-17-32(2)20-38(19-31)36-13-15-49-45(27-36)43-9-5-7-11-47(43)63(49)51-23-35(30-62)24-52(53(51)40-25-41(54(56,57)58)29-42(26-40)55(59,60)61)64-48-12-8-6-10-44(48)46-28-37(14-16-50(46)64)39-21-33(3)18-34(4)22-39/h5-29H,1-4H3 |
| InChIKey | PNAVEXQYHVWIGM-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.91 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |