C52H28F12N6 — CID 138729643
3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 138729643) has the molecular formula C52H28F12N6 and a molecular weight of 964.81 g/mol. Its IUPAC name is 3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 138729643 |
| Molecular Formula | C52H28F12N6 |
| Molecular Weight | 964.81 g/mol |
| Exact Mass | 964.22 |
| IUPAC Name | 3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | Cc1nc(C)nc(-c2c(-n3c4ccccc4c4ccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc43)cc(C#N)cc2-n2c3ccccc3c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc32)n1 |
| InChI | InChI=1S/C52H28F12N6/c1-26-66-27(2)68-48(67-26)47-45(69-41-9-5-3-7-37(41)39-13-11-29(21-43(39)69)31-17-33(49(53,54)55)23-34(18-31)50(56,57)58)15-28(25-65)16-46(47)70-42-10-6-4-8-38(42)40-14-12-30(22-44(40)70)32-19-35(51(59,60)61)24-36(20-32)52(62,63)64/h3-24H,1-2H3 |
| InChIKey | KOWUDLJLRNBFFT-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.81 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |