C55H25F18N3 — CID 134287579
4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile (PubChem CID 134287579) has the molecular formula C55H25F18N3 and a molecular weight of 1069.79 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134287579 |
| Molecular Formula | C55H25F18N3 |
| Molecular Weight | 1069.79 g/mol |
| Exact Mass | 1069.18 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc32)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-n2c3ccccc3c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc32)c1 |
| InChI | InChI=1S/C55H25F18N3/c56-50(57,58)33-15-30(16-34(23-33)51(59,60)61)28-9-11-41-39-5-1-3-7-43(39)75(45(41)21-28)47-13-27(26-74)14-48(49(47)32-19-37(54(68,69)70)25-38(20-32)55(71,72)73)76-44-8-4-2-6-40(44)42-12-10-29(22-46(42)76)31-17-35(52(62,63)64)24-36(18-31)53(65,66)67/h1-25H |
| InChIKey | OOLHWKXOWQGKPI-UHFFFAOYSA-N |
| XLogP | 18.87 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.79 |
| LogP ≤ 5 | 18.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |