C57H32F15N3 — CID 146520138
3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-propan-2-yl-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146520138) has the molecular formula C57H32F15N3 and a molecular weight of 1043.87 g/mol. Its IUPAC name is 3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-propan-2-yl-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-propan-2-yl-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146520138 |
| Molecular Formula | C57H32F15N3 |
| Molecular Weight | 1043.87 g/mol |
| Exact Mass | 1043.24 |
| IUPAC Name | 3,5-bis[2-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-propan-2-yl-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | CC(C)c1cccc(C(F)(F)F)c1-c1c(-n2c3ccccc3c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc32)cc(C#N)cc1-n1c2ccccc2c2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C57H32F15N3/c1-29(2)39-10-7-11-44(57(70,71)72)51(39)52-49(74-45-12-5-3-8-40(45)42-16-14-31(24-47(42)74)33-20-35(53(58,59)60)26-36(21-33)54(61,62)63)18-30(28-73)19-50(52)75-46-13-6-4-9-41(46)43-17-15-32(25-48(43)75)34-22-37(55(64,65)66)27-38(23-34)56(67,68)69/h3-27,29H,1-2H3 |
| InChIKey | NKSIQIMTVKNTNW-UHFFFAOYSA-N |
| XLogP | 18.97 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.87 |
| LogP ≤ 5 | 18.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |