C55H25F15N4 — CID 137382189
3,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137382189) has the molecular formula C55H25F15N4 and a molecular weight of 1026.80 g/mol. Its IUPAC name is 3,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137382189 |
| Molecular Formula | C55H25F15N4 |
| Molecular Weight | 1026.80 g/mol |
| Exact Mass | 1026.18 |
| IUPAC Name | 3,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc32)c(-c2c(C#N)cccc2C(F)(F)F)c(-n2c3ccccc3c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc32)c1 |
| InChI | InChI=1S/C55H25F15N4/c56-51(57,58)34-18-32(19-35(24-34)52(59,60)61)29-12-14-45-40(22-29)38-7-1-3-10-43(38)73(45)47-16-28(26-71)17-48(50(47)49-31(27-72)6-5-9-42(49)55(68,69)70)74-44-11-4-2-8-39(44)41-23-30(13-15-46(41)74)33-20-36(53(62,63)64)25-37(21-33)54(65,66)67/h1-25H |
| InChIKey | JIRVCGOZEIQOMB-UHFFFAOYSA-N |
| XLogP | 17.72 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.80 |
| LogP ≤ 5 | 17.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |