C67H33F6N7 — CID 137392595
3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137392595) has the molecular formula C67H33F6N7 and a molecular weight of 1050.04 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137392595 |
| Molecular Formula | C67H33F6N7 |
| Molecular Weight | 1050.04 g/mol |
| Exact Mass | 1049.27 |
| IUPAC Name | 3,5-bis[3,6-bis(4-cyanophenyl)carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4)ccc2n3-c2cc(C#N)cc(-n3c4ccc(-c5ccc(C#N)cc5)cc4c4cc(-c5ccc(C#N)cc5)ccc43)c2-c2c(C(F)(F)F)cccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C67H33F6N7/c68-66(69,70)56-2-1-3-57(67(71,72)73)64(56)65-62(79-58-24-20-48(44-12-4-39(34-74)5-13-44)30-52(58)53-31-49(21-25-59(53)79)45-14-6-40(35-75)7-15-45)28-43(38-78)29-63(65)80-60-26-22-50(46-16-8-41(36-76)9-17-46)32-54(60)55-33-51(23-27-61(55)80)47-18-10-42(37-77)11-19-47/h1-33H |
| InChIKey | ZIKPOFSWGWRTBD-UHFFFAOYSA-N |
| XLogP | 17.61 |
| TPSA | 128.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.04 |
| LogP ≤ 5 | 17.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |