C71H29F30N3 — CID 137392584
3,5-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137392584) has the molecular formula C71H29F30N3 and a molecular weight of 1493.97 g/mol. Its IUPAC name is 3,5-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137392584 |
| Molecular Formula | C71H29F30N3 |
| Molecular Weight | 1493.97 g/mol |
| Exact Mass | 1493.19 |
| IUPAC Name | 3,5-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-[2,6-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc3c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc32)c(-c2c(C(F)(F)F)cccc2C(F)(F)F)c(-n2c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc3c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C71H29F30N3/c72-62(73,74)36-8-12-40(50(26-36)68(90,91)92)32-4-16-54-44(22-32)45-23-33(41-13-9-37(63(75,76)77)27-51(41)69(93,94)95)5-17-55(45)103(54)58-20-31(30-102)21-59(61(58)60-48(66(84,85)86)2-1-3-49(60)67(87,88)89)104-56-18-6-34(42-14-10-38(64(78,79)80)28-52(42)70(96,97)98)24-46(56)47-25-35(7-19-57(47)104)43-15-11-39(65(81,82)83)29-53(43)71(99,100)101/h1-29H |
| InChIKey | JAQGGDRPPFOERY-UHFFFAOYSA-N |
| XLogP | 26.28 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 104 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1493.97 |
| LogP ≤ 5 | 26.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |